| Name | 1,3-Bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazolium chloride |
| Synonyms | 1,3-DIMESITYLIMIDAZOLIUM CHLORIDE 1,3-(2,4,6-TRIMETHYLPHENYL)IMIDAZOLIUM CHLORIDE 1,3-bis(2,4,6-trimethylphenyl)-1H-imidazol-3-ium 1,3-Bis(2,4,6-trimethylphenyl)imidazoliumchloride 1,3-BIS(2,4,6-TRIMETHYLPHENYL)IMIDAZOLIUM CHLORIDE 1,3-Bis(2,4,6-trimethylphenyl)imidazolium Chloride 1,3-BIS-(2,4,6-TRIMETHYLPHENYL)-1H-IMIDAZOLIUM CHLORIDE N,N'-(2,4,6-TRIMETHYLPHENYL)DIHYDROIMADAZOLIUM CHLORIDE 1,3-bis(2,4,6-trimethylphenyl)-1H-imidazol-3-ium chloride 1,3-BIS(2,4,6-TRIMETHYLPHENYL)-4,5-DIHYDROIMIDAZOLIUM CHLORIDE 1,3-Bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazolium chloride 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydro-1H-imidazol-3-ium chloride |
| CAS | 141556-45-8 |
| InChI | InChI=1/C21H27N2.ClH/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;/h9-13H,7-8H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | OTOSIXGMLYKKOW-UHFFFAOYSA-M |
| Molecular Formula | C21H25ClN2 |
| Molar Mass | 340.89 |
| Density | 1.0279 (rough estimate) |
| Melting Point | >300 °C (lit.) |
| Boling Point | 499.2°C (rough estimate) |
| Water Solubility | Slightly soluble in water. |
| Appearance | White to Brown Powder |
| Color | Off-white to beige |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.5940 (estimate) |
| MDL | MFCD02684541 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29332900 |
| use | important pharmaceutical intermediates |